C20H19BN2O5 — CID 167499193
CID 167499193 (PubChem CID 167499193) has the molecular formula C20H19BN2O5 and a molecular weight of 378.19 g/mol.
| Compound Name | CID 167499193 |
|---|---|
| PubChem CID | 167499193 |
| Molecular Formula | C20H19BN2O5 |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | — |
| SMILES | [B]C(O)(O)N(CC(=O)NC)c1ccc2c(-c3ccccc3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H19BN2O5/c1-12-5-3-4-6-14(12)16-10-19(25)28-17-9-13(7-8-15(16)17)23(20(21,26)27)11-18(24)22-2/h3-10,26-27H,11H2,1-2H3,(H,22,24) |
| InChIKey | FFYGHASZFXQPEC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|