About CID 167499193
CID 167499193 (PubChem CID 167499193) has the molecular formula C20H19BN2O5
and a molecular weight of 378.19 g/mol.
Molecular Properties
| Compound Name | CID 167499193 |
| PubChem CID | 167499193 |
| Molecular Formula | C20H19BN2O5 |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | — |
| SMILES | [B]C(O)(O)N(CC(=O)NC)c1ccc2c(-c3ccccc3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H19BN2O5/c1-12-5-3-4-6-14(12)16-10-19(25)28-17-9-13(7-8-15(16)17)23(20(21,26)27)11-18(24)22-2/h3-10,26-27H,11H2,1-2H3,(H,22,24) |
| InChIKey | FFYGHASZFXQPEC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 167499193 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167499193?
The IUPAC name of CID 167499193 (CID 167499193) is not available.
What is the SMILES notation for CID 167499193?
The canonical SMILES for CID 167499193 is [B]C(O)(O)N(CC(=O)NC)c1ccc2c(-c3ccccc3C)cc(=O)oc2c1.
What is the InChIKey of CID 167499193?
The InChIKey is FFYGHASZFXQPEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19BN2O5/c1-12-5-3-4-6-14(12)16-10-19(25)28-17-9-13(7-8-15(16)17)23(20(21,26)27)11-18(24)22-2/h3-10,26-27H,11H2,1-2H3,(H,22,24).
What are the key properties of CID 167499193?
CID 167499193 has a molecular weight of 378.19 g/mol, XLogP of 1.09, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167499193 is sourced from PubChem (CID 167499193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).