C19H16O2 — CID 167498753
7-cyclopropyl-4-(2-methylphenyl)chromen-2-one (PubChem CID 167498753) has the molecular formula C19H16O2 and a molecular weight of 276.33 g/mol. Its IUPAC name is 7-cyclopropyl-4-(2-methylphenyl)chromen-2-one.
| Compound Name | 7-cyclopropyl-4-(2-methylphenyl)chromen-2-one |
|---|---|
| PubChem CID | 167498753 |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 7-cyclopropyl-4-(2-methylphenyl)chromen-2-one |
| SMILES | Cc1ccccc1-c1cc(=O)oc2cc(C3CC3)ccc12 |
| InChI | InChI=1S/C19H16O2/c1-12-4-2-3-5-15(12)17-11-19(20)21-18-10-14(13-6-7-13)8-9-16(17)18/h2-5,8-11,13H,6-7H2,1H3 |
| InChIKey | OWNJNCNGMBVAQH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|