C24H30ClF2N3O2 — CID 146412945
ethyl 3-[3-amino-4-[amino(cyclopropylmethyl)amino]-2-(difluoromethyl)phenyl]-3-[3-(chloromethyl)-4-methylphenyl]propanoate (PubChem CID 146412945) has the molecular formula C24H30ClF2N3O2 and a molecular weight of 465.97 g/mol. Its IUPAC name is ethyl 3-[3-amino-4-[amino(cyclopropylmethyl)amino]-2-(difluoromethyl)phenyl]-3-[3-(chloromethyl)-4-methylphenyl]propanoate.
| Compound Name | ethyl 3-[3-amino-4-[amino(cyclopropylmethyl)amino]-2-(difluoromethyl)phenyl]-3-[3-(chloromethyl)-4-methylphenyl]propanoate |
|---|---|
| PubChem CID | 146412945 |
| Molecular Formula | C24H30ClF2N3O2 |
| Molecular Weight | 465.97 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | ethyl 3-[3-amino-4-[amino(cyclopropylmethyl)amino]-2-(difluoromethyl)phenyl]-3-[3-(chloromethyl)-4-methylphenyl]propanoate |
| SMILES | CCOC(=O)CC(c1ccc(C)c(CCl)c1)c1ccc(N(N)CC2CC2)c(N)c1C(F)F |
| InChI | InChI=1S/C24H30ClF2N3O2/c1-3-32-21(31)11-19(16-7-4-14(2)17(10-16)12-25)18-8-9-20(23(28)22(18)24(26)27)30(29)13-15-5-6-15/h4,7-10,15,19,24H,3,5-6,11-13,28-29H2,1-2H3 |
| InChIKey | BMZVQQZNJZXLSR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.97 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|