C21H28ClN3O2 — CID 135142292
methyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-(4-chloro-3-methylphenyl)-2,2-dimethylpropanoate (PubChem CID 135142292) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is methyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-(4-chloro-3-methylphenyl)-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-(4-chloro-3-methylphenyl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135142292 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | methyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-(4-chloro-3-methylphenyl)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)C(c1ccc(Cl)c(C)c1)c1ccc(N(C)N)c(N)c1C |
| InChI | InChI=1S/C21H28ClN3O2/c1-12-11-14(7-9-16(12)22)18(21(3,4)20(26)27-6)15-8-10-17(25(5)24)19(23)13(15)2/h7-11,18H,23-24H2,1-6H3 |
| InChIKey | DFYIYUFVFXQRAC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|