C20H23Cl2N3O2 — CID 135149776
ethyl 3-[3-[4-chloro-3-(chloromethyl)phenyl]-1,4-dimethyl-2H-benzotriazol-5-yl]propanoate (PubChem CID 135149776) has the molecular formula C20H23Cl2N3O2 and a molecular weight of 408.33 g/mol. Its IUPAC name is ethyl 3-[3-[4-chloro-3-(chloromethyl)phenyl]-1,4-dimethyl-2H-benzotriazol-5-yl]propanoate.
| Compound Name | ethyl 3-[3-[4-chloro-3-(chloromethyl)phenyl]-1,4-dimethyl-2H-benzotriazol-5-yl]propanoate |
|---|---|
| PubChem CID | 135149776 |
| Molecular Formula | C20H23Cl2N3O2 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | ethyl 3-[3-[4-chloro-3-(chloromethyl)phenyl]-1,4-dimethyl-2H-benzotriazol-5-yl]propanoate |
| SMILES | CCOC(=O)CCc1ccc2c(c1C)N(c1ccc(Cl)c(CCl)c1)NN2C |
| InChI | InChI=1S/C20H23Cl2N3O2/c1-4-27-19(26)10-6-14-5-9-18-20(13(14)2)25(23-24(18)3)16-7-8-17(22)15(11-16)12-21/h5,7-9,11,23H,4,6,10,12H2,1-3H3 |
| InChIKey | DUDYYWCTGKJWLG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|