C23H30ClN3O2 — CID 166852282
ethyl (3S)-3-[3-(chloromethyl)-4-methylphenyl]-3-(1-ethyl-2,4-dimethyl-3H-benzotriazol-5-yl)propanoate (PubChem CID 166852282) has the molecular formula C23H30ClN3O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is ethyl (3S)-3-[3-(chloromethyl)-4-methylphenyl]-3-(1-ethyl-2,4-dimethyl-3H-benzotriazol-5-yl)propanoate.
| Compound Name | ethyl (3S)-3-[3-(chloromethyl)-4-methylphenyl]-3-(1-ethyl-2,4-dimethyl-3H-benzotriazol-5-yl)propanoate |
|---|---|
| PubChem CID | 166852282 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | ethyl (3S)-3-[3-(chloromethyl)-4-methylphenyl]-3-(1-ethyl-2,4-dimethyl-3H-benzotriazol-5-yl)propanoate |
| SMILES | CCOC(=O)C[C@@H](c1ccc(C)c(CCl)c1)c1ccc2c(c1C)NN(C)N2CC |
| InChI | InChI=1S/C23H30ClN3O2/c1-6-27-21-11-10-19(16(4)23(21)25-26(27)5)20(13-22(28)29-7-2)17-9-8-15(3)18(12-17)14-24/h8-12,20,25H,6-7,13-14H2,1-5H3/t20-/m0/s1 |
| InChIKey | CJHCPZYVYIRFPC-FQEVSTJZSA-N |
| XLogP | 5.14 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|