C22H30N2O2 — CID 135142398
ethyl 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-(3,4-dimethylphenyl)propanoate (PubChem CID 135142398) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is ethyl 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-(3,4-dimethylphenyl)propanoate.
| Compound Name | ethyl 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-(3,4-dimethylphenyl)propanoate |
|---|---|
| PubChem CID | 135142398 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | ethyl 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-(3,4-dimethylphenyl)propanoate |
| SMILES | CCNc1ccc(C(CC(=O)OCC)c2ccc(C)c(C)c2)c(C)c1N |
| InChI | InChI=1S/C22H30N2O2/c1-6-24-20-11-10-18(16(5)22(20)23)19(13-21(25)26-7-2)17-9-8-14(3)15(4)12-17/h8-12,19,24H,6-7,13,23H2,1-5H3 |
| InChIKey | SBBNFRKYDDYHFP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|