C22H30N2O2 — CID 135138829
methyl 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-(3,4-dimethylphenyl)-2,2-dimethylpropanoate (PubChem CID 135138829) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is methyl 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-(3,4-dimethylphenyl)-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-(3,4-dimethylphenyl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135138829 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | methyl 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-(3,4-dimethylphenyl)-2,2-dimethylpropanoate |
| SMILES | CNc1ccc(C(c2ccc(C)c(C)c2)C(C)(C)C(=O)OC)c(C)c1N |
| InChI | InChI=1S/C22H30N2O2/c1-13-8-9-16(12-14(13)2)19(22(4,5)21(25)26-7)17-10-11-18(24-6)20(23)15(17)3/h8-12,19,24H,23H2,1-7H3 |
| InChIKey | UYBXSZAUUMNIPY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|