C31H45N5O3 — CID 135138775
3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(4-cyclopropyl-6,6-dimethyl-3-oxo-1,4-diazepan-1-yl)methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid (PubChem CID 135138775) has the molecular formula C31H45N5O3 and a molecular weight of 535.73 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(4-cyclopropyl-6,6-dimethyl-3-oxo-1,4-diazepan-1-yl)methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(4-cyclopropyl-6,6-dimethyl-3-oxo-1,4-diazepan-1-yl)methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 135138775 |
| Molecular Formula | C31H45N5O3 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.35 |
| IUPAC Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(4-cyclopropyl-6,6-dimethyl-3-oxo-1,4-diazepan-1-yl)methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid |
| SMILES | Cc1ccc(C(c2ccc(N(C)N)c(N)c2C)C(C)(C)C(=O)O)cc1CN1CC(=O)N(C2CC2)CC(C)(C)C1 |
| InChI | InChI=1S/C31H45N5O3/c1-19-8-9-21(14-22(19)15-35-16-26(37)36(23-10-11-23)18-30(3,4)17-35)27(31(5,6)29(38)39)24-12-13-25(34(7)33)28(32)20(24)2/h8-9,12-14,23,27H,10-11,15-18,32-33H2,1-7H3,(H,38,39) |
| InChIKey | BUTKATZNALQZCB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|