C29H43N5O3 — CID 135138861
3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[(4,6,6-trimethyl-3-oxo-1,4-diazepan-1-yl)methyl]phenyl]propanoic acid (PubChem CID 135138861) has the molecular formula C29H43N5O3 and a molecular weight of 509.70 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[(4,6,6-trimethyl-3-oxo-1,4-diazepan-1-yl)methyl]phenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[(4,6,6-trimethyl-3-oxo-1,4-diazepan-1-yl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 135138861 |
| Molecular Formula | C29H43N5O3 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.34 |
| IUPAC Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[(4,6,6-trimethyl-3-oxo-1,4-diazepan-1-yl)methyl]phenyl]propanoic acid |
| SMILES | Cc1ccc(C(c2ccc(N(C)N)c(N)c2C)C(C)(C)C(=O)O)cc1CN1CC(=O)N(C)CC(C)(C)C1 |
| InChI | InChI=1S/C29H43N5O3/c1-18-9-10-20(13-21(18)14-34-15-24(35)32(7)16-28(3,4)17-34)25(29(5,6)27(36)37)22-11-12-23(33(8)31)26(30)19(22)2/h9-13,25H,14-17,30-31H2,1-8H3,(H,36,37) |
| InChIKey | ZIFNKDWDINCIHZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|