C22H30N2O2 — CID 135138769
3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-(3-ethyl-4-methylphenyl)-2,2-dimethylpropanoic acid (PubChem CID 135138769) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-(3-ethyl-4-methylphenyl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-(3-ethyl-4-methylphenyl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 135138769 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-(3-ethyl-4-methylphenyl)-2,2-dimethylpropanoic acid |
| SMILES | CCc1cc(C(c2ccc(NC)c(N)c2C)C(C)(C)C(=O)O)ccc1C |
| InChI | InChI=1S/C22H30N2O2/c1-7-15-12-16(9-8-13(15)2)19(22(4,5)21(25)26)17-10-11-18(24-6)20(23)14(17)3/h8-12,19,24H,7,23H2,1-6H3,(H,25,26) |
| InChIKey | FZRWEELLBVXHDX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|