C34H43F3N4O2 — CID 135142261
3-[4-[amino(ethyl)amino]-2-methyl-3-(methylamino)phenyl]-2,2-dimethyl-3-[4-methyl-3-[[9-(trifluoromethyl)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]methyl]phenyl]propanoic acid (PubChem CID 135142261) has the molecular formula C34H43F3N4O2 and a molecular weight of 596.74 g/mol. Its IUPAC name is 3-[4-[amino(ethyl)amino]-2-methyl-3-(methylamino)phenyl]-2,2-dimethyl-3-[4-methyl-3-[[9-(trifluoromethyl)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]methyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[amino(ethyl)amino]-2-methyl-3-(methylamino)phenyl]-2,2-dimethyl-3-[4-methyl-3-[[9-(trifluoromethyl)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 135142261 |
| Molecular Formula | C34H43F3N4O2 |
| Molecular Weight | 596.74 g/mol |
| Exact Mass | 596.33 |
| IUPAC Name | 3-[4-[amino(ethyl)amino]-2-methyl-3-(methylamino)phenyl]-2,2-dimethyl-3-[4-methyl-3-[[9-(trifluoromethyl)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]methyl]phenyl]propanoic acid |
| SMILES | CCN(N)c1ccc(C(c2ccc(C)c(CN3CCCc4cccc(C(F)(F)F)c4C3)c2)C(C)(C)C(=O)O)c(C)c1NC |
| InChI | InChI=1S/C34H43F3N4O2/c1-7-41(38)29-16-15-26(22(3)31(29)39-6)30(33(4,5)32(42)43)24-14-13-21(2)25(18-24)19-40-17-9-11-23-10-8-12-28(27(23)20-40)34(35,36)37/h8,10,12-16,18,30,39H,7,9,11,17,19-20,38H2,1-6H3,(H,42,43) |
| InChIKey | KGMYGOZBUJQUPM-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.74 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|