C40H47F3N4O2 — CID 135141702
benzyl 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[[9-(trifluoromethyl)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]methyl]phenyl]propanoate (PubChem CID 135141702) has the molecular formula C40H47F3N4O2 and a molecular weight of 672.84 g/mol. Its IUPAC name is benzyl 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[[9-(trifluoromethyl)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]methyl]phenyl]propanoate.
| Compound Name | benzyl 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[[9-(trifluoromethyl)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 135141702 |
| Molecular Formula | C40H47F3N4O2 |
| Molecular Weight | 672.84 g/mol |
| Exact Mass | 672.37 |
| IUPAC Name | benzyl 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[[9-(trifluoromethyl)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]methyl]phenyl]propanoate |
| SMILES | CCN(N)c1ccc(C(c2ccc(C)c(CN3CCCc4cccc(C(F)(F)F)c4C3)c2)C(C)(C)C(=O)OCc2ccccc2)c(C)c1N |
| InChI | InChI=1S/C40H47F3N4O2/c1-6-47(45)35-20-19-32(27(3)37(35)44)36(39(4,5)38(48)49-25-28-12-8-7-9-13-28)30-18-17-26(2)31(22-30)23-46-21-11-15-29-14-10-16-34(33(29)24-46)40(41,42)43/h7-10,12-14,16-20,22,36H,6,11,15,21,23-25,44-45H2,1-5H3 |
| InChIKey | OIVNKIPFXQIKJC-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.84 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|