C32H42N6O2 — CID 155179030
3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[[2-(2-azatricyclo[4.2.0.01,3]octan-2-ylmethyl)imidazol-1-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid (PubChem CID 155179030) has the molecular formula C32H42N6O2 and a molecular weight of 542.73 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[[2-(2-azatricyclo[4.2.0.01,3]octan-2-ylmethyl)imidazol-1-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[[2-(2-azatricyclo[4.2.0.01,3]octan-2-ylmethyl)imidazol-1-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 155179030 |
| Molecular Formula | C32H42N6O2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[[2-(2-azatricyclo[4.2.0.01,3]octan-2-ylmethyl)imidazol-1-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid |
| SMILES | Cc1ccc(C(c2ccc(N(C)N)c(N)c2C)C(C)(C)C(=O)O)cc1Cn1ccnc1CN1C2CCC3CCC321 |
| InChI | InChI=1S/C32H42N6O2/c1-19-6-7-21(28(31(3,4)30(39)40)24-9-10-25(36(5)34)29(33)20(24)2)16-22(19)17-37-15-14-35-27(37)18-38-26-11-8-23-12-13-32(23,26)38/h6-7,9-10,14-16,23,26,28H,8,11-13,17-18,33-34H2,1-5H3,(H,39,40) |
| InChIKey | FGPAEBJDDKGRRY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|