C31H46N6O2S — CID 135143219
3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[4-[[2-[(4-ethylpiperidin-1-yl)methyl]imidazol-1-yl]methyl]-5-methylthiophen-2-yl]-2,2-dimethylpropanoic acid (PubChem CID 135143219) has the molecular formula C31H46N6O2S and a molecular weight of 566.82 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[4-[[2-[(4-ethylpiperidin-1-yl)methyl]imidazol-1-yl]methyl]-5-methylthiophen-2-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[4-[[2-[(4-ethylpiperidin-1-yl)methyl]imidazol-1-yl]methyl]-5-methylthiophen-2-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 135143219 |
| Molecular Formula | C31H46N6O2S |
| Molecular Weight | 566.82 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[4-[[2-[(4-ethylpiperidin-1-yl)methyl]imidazol-1-yl]methyl]-5-methylthiophen-2-yl]-2,2-dimethylpropanoic acid |
| SMILES | CCC1CCN(Cc2nccn2Cc2cc(C(c3ccc(N(N)CC)c(N)c3C)C(C)(C)C(=O)O)sc2C)CC1 |
| InChI | InChI=1S/C31H46N6O2S/c1-7-22-11-14-35(15-12-22)19-27-34-13-16-36(27)18-23-17-26(40-21(23)4)28(31(5,6)30(38)39)24-9-10-25(37(33)8-2)29(32)20(24)3/h9-10,13,16-17,22,28H,7-8,11-12,14-15,18-19,32-33H2,1-6H3,(H,38,39) |
| InChIKey | MAPBGTLTFJCIRK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.82 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|