C30H33FN2O5 — CID 175695967
3-[3-(2,2-dimethyl-3,5-dihydropyrido[3,2-f][1,4]oxazepin-4-yl)-2,3-dihydro-1H-inden-5-yl]-3-(4-fluoro-2-methylphenyl)propanoic acid;formic acid (PubChem CID 175695967) has the molecular formula C30H33FN2O5 and a molecular weight of 520.60 g/mol. Its IUPAC name is 3-[3-(2,2-dimethyl-3,5-dihydropyrido[3,2-f][1,4]oxazepin-4-yl)-2,3-dihydro-1H-inden-5-yl]-3-(4-fluoro-2-methylphenyl)propanoic acid;formic acid.
| Compound Name | 3-[3-(2,2-dimethyl-3,5-dihydropyrido[3,2-f][1,4]oxazepin-4-yl)-2,3-dihydro-1H-inden-5-yl]-3-(4-fluoro-2-methylphenyl)propanoic acid;formic acid |
|---|---|
| PubChem CID | 175695967 |
| Molecular Formula | C30H33FN2O5 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 3-[3-(2,2-dimethyl-3,5-dihydropyrido[3,2-f][1,4]oxazepin-4-yl)-2,3-dihydro-1H-inden-5-yl]-3-(4-fluoro-2-methylphenyl)propanoic acid;formic acid |
| SMILES | Cc1cc(F)ccc1C(CC(=O)O)c1ccc2c(c1)C(N1Cc3cccnc3OC(C)(C)C1)CC2.O=CO |
| InChI | InChI=1S/C29H31FN2O3.CH2O2/c1-18-13-22(30)9-10-23(18)24(15-27(33)34)20-7-6-19-8-11-26(25(19)14-20)32-16-21-5-4-12-31-28(21)35-29(2,3)17-32;2-1-3/h4-7,9-10,12-14,24,26H,8,11,15-17H2,1-3H3,(H,33,34);1H,(H,2,3) |
| InChIKey | BADDJZUCBSQVBT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|