C30H38ClN5O3 — CID 155178953
3-[3-amino-4-[amino(ethyl)amino]-2-chlorophenyl]-3-[3-[(2,2-dimethyl-3,5-dihydropyrido[3,2-f][1,4]oxazepin-4-yl)methyl]-4-methylphenyl]-2-methylpropanoic acid (PubChem CID 155178953) has the molecular formula C30H38ClN5O3 and a molecular weight of 552.12 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(ethyl)amino]-2-chlorophenyl]-3-[3-[(2,2-dimethyl-3,5-dihydropyrido[3,2-f][1,4]oxazepin-4-yl)methyl]-4-methylphenyl]-2-methylpropanoic acid.
| Compound Name | 3-[3-amino-4-[amino(ethyl)amino]-2-chlorophenyl]-3-[3-[(2,2-dimethyl-3,5-dihydropyrido[3,2-f][1,4]oxazepin-4-yl)methyl]-4-methylphenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 155178953 |
| Molecular Formula | C30H38ClN5O3 |
| Molecular Weight | 552.12 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | 3-[3-amino-4-[amino(ethyl)amino]-2-chlorophenyl]-3-[3-[(2,2-dimethyl-3,5-dihydropyrido[3,2-f][1,4]oxazepin-4-yl)methyl]-4-methylphenyl]-2-methylpropanoic acid |
| SMILES | CCN(N)c1ccc(C(c2ccc(C)c(CN3Cc4cccnc4OC(C)(C)C3)c2)C(C)C(=O)O)c(Cl)c1N |
| InChI | InChI=1S/C30H38ClN5O3/c1-6-36(33)24-12-11-23(26(31)27(24)32)25(19(3)29(37)38)20-10-9-18(2)22(14-20)16-35-15-21-8-7-13-34-28(21)39-30(4,5)17-35/h7-14,19,25H,6,15-17,32-33H2,1-5H3,(H,37,38) |
| InChIKey | IMNSPKOHRKSJEF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.12 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|