C29H44N4O4 — CID 135275599
tert-butyl 7-[(5E,7E)-9-amino-8-[amino(ethyl)amino]-3-methoxycarbonyl-5-methyldeca-5,7,9-trien-4-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 135275599) has the molecular formula C29H44N4O4 and a molecular weight of 512.70 g/mol. Its IUPAC name is tert-butyl 7-[(5E,7E)-9-amino-8-[amino(ethyl)amino]-3-methoxycarbonyl-5-methyldeca-5,7,9-trien-4-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 7-[(5E,7E)-9-amino-8-[amino(ethyl)amino]-3-methoxycarbonyl-5-methyldeca-5,7,9-trien-4-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 135275599 |
| Molecular Formula | C29H44N4O4 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | tert-butyl 7-[(5E,7E)-9-amino-8-[amino(ethyl)amino]-3-methoxycarbonyl-5-methyldeca-5,7,9-trien-4-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | C=C(N)/C(=C\C=C(/C)C(c1ccc2c(c1)CN(C(=O)OC(C)(C)C)CC2)C(CC)C(=O)OC)N(N)CC |
| InChI | InChI=1S/C29H44N4O4/c1-9-24(27(34)36-8)26(19(3)11-14-25(20(4)30)33(31)10-2)22-13-12-21-15-16-32(18-23(21)17-22)28(35)37-29(5,6)7/h11-14,17,24,26H,4,9-10,15-16,18,30-31H2,1-3,5-8H3/b19-11+,25-14+ |
| InChIKey | GPFNWKAJEFHELM-QRHHGLBLSA-N |
| XLogP | 4.76 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|