C22H33N3O2 — CID 154680526
6-[amino(methyl)amino]-3-[(1R)-1-(3,4-dimethylphenyl)propyl]-2-methylaniline;ethyl formate (PubChem CID 154680526) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 6-[amino(methyl)amino]-3-[(1R)-1-(3,4-dimethylphenyl)propyl]-2-methylaniline;ethyl formate.
| Compound Name | 6-[amino(methyl)amino]-3-[(1R)-1-(3,4-dimethylphenyl)propyl]-2-methylaniline;ethyl formate |
|---|---|
| PubChem CID | 154680526 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 6-[amino(methyl)amino]-3-[(1R)-1-(3,4-dimethylphenyl)propyl]-2-methylaniline;ethyl formate |
| SMILES | CCOC=O.CC[C@H](c1ccc(C)c(C)c1)c1ccc(N(C)N)c(N)c1C |
| InChI | InChI=1S/C19H27N3.C3H6O2/c1-6-16(15-8-7-12(2)13(3)11-15)17-9-10-18(22(5)21)19(20)14(17)4;1-2-5-3-4/h7-11,16H,6,20-21H2,1-5H3;3H,2H2,1H3/t16-;/m1./s1 |
| InChIKey | KFIWETQKLIDNRF-PKLMIRHRSA-N |
| XLogP | 4.23 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|