C35H41N3O4 — CID 155179042
benzyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]-2-methylpropanoate (PubChem CID 155179042) has the molecular formula C35H41N3O4 and a molecular weight of 567.73 g/mol. Its IUPAC name is benzyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]-2-methylpropanoate.
| Compound Name | benzyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 155179042 |
| Molecular Formula | C35H41N3O4 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.31 |
| IUPAC Name | benzyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]-2-methylpropanoate |
| SMILES | COc1ccc(COCc2cc(C(c3ccc(N(C)N)c(N)c3C)C(C)C(=O)OCc3ccccc3)ccc2C)cc1 |
| InChI | InChI=1S/C35H41N3O4/c1-23-11-14-28(19-29(23)22-41-20-27-12-15-30(40-5)16-13-27)33(31-17-18-32(38(4)37)34(36)24(31)2)25(3)35(39)42-21-26-9-7-6-8-10-26/h6-19,25,33H,20-22,36-37H2,1-5H3 |
| InChIKey | OLOZLBDBOSEPQO-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|