C25H30N2O3 — CID 144867631
[3-amino-2-methyl-4-(methylamino)phenyl]-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]methanol (PubChem CID 144867631) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is [3-amino-2-methyl-4-(methylamino)phenyl]-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]methanol.
| Compound Name | [3-amino-2-methyl-4-(methylamino)phenyl]-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]methanol |
|---|---|
| PubChem CID | 144867631 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | [3-amino-2-methyl-4-(methylamino)phenyl]-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]methanol |
| SMILES | CNc1ccc(C(O)c2ccc(C)c(COCc3ccc(OC)cc3)c2)c(C)c1N |
| InChI | InChI=1S/C25H30N2O3/c1-16-5-8-19(25(28)22-11-12-23(27-3)24(26)17(22)2)13-20(16)15-30-14-18-6-9-21(29-4)10-7-18/h5-13,25,27-28H,14-15,26H2,1-4H3 |
| InChIKey | LGVAYKVEUIVURT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|