C29H37N3O4 — CID 155179029
methyl 3-[3-amino-4-[amino(methyl)amino]phenyl]-3-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]-2,2-dimethylpropanoate (PubChem CID 155179029) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is methyl 3-[3-amino-4-[amino(methyl)amino]phenyl]-3-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[3-amino-4-[amino(methyl)amino]phenyl]-3-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 155179029 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | methyl 3-[3-amino-4-[amino(methyl)amino]phenyl]-3-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)C(c1ccc(N(C)N)c(N)c1)c1ccc(C)c(COCc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C29H37N3O4/c1-19-7-10-21(15-23(19)18-36-17-20-8-12-24(34-5)13-9-20)27(29(2,3)28(33)35-6)22-11-14-26(32(4)31)25(30)16-22/h7-16,27H,17-18,30-31H2,1-6H3 |
| InChIKey | OCANDSHDUQGACV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|