C24H31BrO2Si — CID 140880656
[5-bromo-5-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]pent-1-ynyl]-trimethylsilane (PubChem CID 140880656) has the molecular formula C24H31BrO2Si and a molecular weight of 459.50 g/mol. Its IUPAC name is [5-bromo-5-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]pent-1-ynyl]-trimethylsilane.
| Compound Name | [5-bromo-5-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]pent-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 140880656 |
| Molecular Formula | C24H31BrO2Si |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [5-bromo-5-[3-[(4-methoxyphenyl)methoxymethyl]-4-methylphenyl]pent-1-ynyl]-trimethylsilane |
| SMILES | COc1ccc(COCc2cc(C(Br)CCC#C[Si](C)(C)C)ccc2C)cc1 |
| InChI | InChI=1S/C24H31BrO2Si/c1-19-9-12-21(24(25)8-6-7-15-28(3,4)5)16-22(19)18-27-17-20-10-13-23(26-2)14-11-20/h9-14,16,24H,6,8,17-18H2,1-5H3 |
| InChIKey | VHQJCYGFTCAQJM-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|