C22H28N2O3 — CID 142376544
methane;methyl 3-(3,4-diaminophenyl)-2,2-dimethyl-3-(3-oxo-1,2-dihydroinden-5-yl)propanoate (PubChem CID 142376544) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is methane;methyl 3-(3,4-diaminophenyl)-2,2-dimethyl-3-(3-oxo-1,2-dihydroinden-5-yl)propanoate.
| Compound Name | methane;methyl 3-(3,4-diaminophenyl)-2,2-dimethyl-3-(3-oxo-1,2-dihydroinden-5-yl)propanoate |
|---|---|
| PubChem CID | 142376544 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | methane;methyl 3-(3,4-diaminophenyl)-2,2-dimethyl-3-(3-oxo-1,2-dihydroinden-5-yl)propanoate |
| SMILES | C.COC(=O)C(C)(C)C(c1ccc(N)c(N)c1)c1ccc2c(c1)C(=O)CC2 |
| InChI | InChI=1S/C21H24N2O3.CH4/c1-21(2,20(25)26-3)19(14-6-8-16(22)17(23)11-14)13-5-4-12-7-9-18(24)15(12)10-13;/h4-6,8,10-11,19H,7,9,22-23H2,1-3H3;1H4 |
| InChIKey | KLWLIXVVCYJZJC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|