C14H17NO2 — CID 11817110
(5R)-5-methyl-3-phenyl-5-propan-2-yl-2H-1,4-oxazin-6-one (PubChem CID 11817110) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is (5R)-5-methyl-3-phenyl-5-propan-2-yl-2H-1,4-oxazin-6-one.
| Compound Name | (5R)-5-methyl-3-phenyl-5-propan-2-yl-2H-1,4-oxazin-6-one |
|---|---|
| PubChem CID | 11817110 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (5R)-5-methyl-3-phenyl-5-propan-2-yl-2H-1,4-oxazin-6-one |
| SMILES | CC(C)[C@@]1(C)N=C(c2ccccc2)COC1=O |
| InChI | InChI=1S/C14H17NO2/c1-10(2)14(3)13(16)17-9-12(15-14)11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3/t14-/m1/s1 |
| InChIKey | KVCPCLHNKXEODB-CQSZACIVSA-N |
| XLogP | 2.45 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |