C8H16O3 — CID 118171219
(2R,5S)-2,5-bis(methoxymethyl)oxolane (PubChem CID 118171219) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (2R,5S)-2,5-bis(methoxymethyl)oxolane.
| Compound Name | (2R,5S)-2,5-bis(methoxymethyl)oxolane |
|---|---|
| PubChem CID | 118171219 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (2R,5S)-2,5-bis(methoxymethyl)oxolane |
| SMILES | COC[C@H]1CC[C@@H](COC)O1 |
| InChI | InChI=1S/C8H16O3/c1-9-5-7-3-4-8(11-7)6-10-2/h7-8H,3-6H2,1-2H3/t7-,8+ |
| InChIKey | FRBJEDLSFZZCFY-OCAPTIKFSA-N |
| XLogP | 0.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |