C13H21F3N4O2S — CID 118171327
1-[(1-ethylsulfonylpiperidin-4-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine (PubChem CID 118171327) has the molecular formula C13H21F3N4O2S and a molecular weight of 354.40 g/mol. Its IUPAC name is 1-[(1-ethylsulfonylpiperidin-4-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine.
| Compound Name | 1-[(1-ethylsulfonylpiperidin-4-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 118171327 |
| Molecular Formula | C13H21F3N4O2S |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 1-[(1-ethylsulfonylpiperidin-4-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine |
| SMILES | CCS(=O)(=O)N1CCC(Cn2nc(C(F)(F)F)c(N)c2C)CC1 |
| InChI | InChI=1S/C13H21F3N4O2S/c1-3-23(21,22)19-6-4-10(5-7-19)8-20-9(2)11(17)12(18-20)13(14,15)16/h10H,3-8,17H2,1-2H3 |
| InChIKey | AUOCUZNWPPKJQT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |