C10H23ClN2O2S — CID 120718277
2-(1-ethylsulfonylpiperidin-4-yl)-N-methylethanamine;hydrochloride (PubChem CID 120718277) has the molecular formula C10H23ClN2O2S and a molecular weight of 270.83 g/mol. Its IUPAC name is 2-(1-ethylsulfonylpiperidin-4-yl)-N-methylethanamine;hydrochloride.
| Compound Name | 2-(1-ethylsulfonylpiperidin-4-yl)-N-methylethanamine;hydrochloride |
|---|---|
| PubChem CID | 120718277 |
| Molecular Formula | C10H23ClN2O2S |
| Molecular Weight | 270.83 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(1-ethylsulfonylpiperidin-4-yl)-N-methylethanamine;hydrochloride |
| SMILES | CCS(=O)(=O)N1CCC(CCNC)CC1.Cl |
| InChI | InChI=1S/C10H22N2O2S.ClH/c1-3-15(13,14)12-8-5-10(6-9-12)4-7-11-2;/h10-11H,3-9H2,1-2H3;1H |
| InChIKey | WZVCOQKFDRIPOA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.83 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |