C12H23ClN4O2S — CID 120718316
N-methyl-2-[1-(1-methylpyrazol-4-yl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride (PubChem CID 120718316) has the molecular formula C12H23ClN4O2S and a molecular weight of 322.86 g/mol. Its IUPAC name is N-methyl-2-[1-(1-methylpyrazol-4-yl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride.
| Compound Name | N-methyl-2-[1-(1-methylpyrazol-4-yl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120718316 |
| Molecular Formula | C12H23ClN4O2S |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-methyl-2-[1-(1-methylpyrazol-4-yl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride |
| SMILES | CNCCC1CCN(S(=O)(=O)c2cnn(C)c2)CC1.Cl |
| InChI | InChI=1S/C12H22N4O2S.ClH/c1-13-6-3-11-4-7-16(8-5-11)19(17,18)12-9-14-15(2)10-12;/h9-11,13H,3-8H2,1-2H3;1H |
| InChIKey | VLNVBOWGBYXCAY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |