C9H21ClN2O2S — CID 17221589
N-methyl-2-(1-methylsulfonylpiperidin-4-yl)ethanamine;hydrochloride (PubChem CID 17221589) has the molecular formula C9H21ClN2O2S and a molecular weight of 256.80 g/mol. Its IUPAC name is N-methyl-2-(1-methylsulfonylpiperidin-4-yl)ethanamine;hydrochloride.
| Compound Name | N-methyl-2-(1-methylsulfonylpiperidin-4-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17221589 |
| Molecular Formula | C9H21ClN2O2S |
| Molecular Weight | 256.80 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-methyl-2-(1-methylsulfonylpiperidin-4-yl)ethanamine;hydrochloride |
| SMILES | CNCCC1CCN(S(C)(=O)=O)CC1.Cl |
| InChI | InChI=1S/C9H20N2O2S.ClH/c1-10-6-3-9-4-7-11(8-5-9)14(2,12)13;/h9-10H,3-8H2,1-2H3;1H |
| InChIKey | WZYGHGPRUAXFCR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.80 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |