About 2-[4-[2-(methylamino)ethyl]cyclohexyl]ethyl methanesulfonate;hydrochloride
2-[4-[2-(methylamino)ethyl]cyclohexyl]ethyl methanesulfonate;hydrochloride (PubChem CID 87926703) has the molecular formula C12H26ClNO3S
and a molecular weight of 299.86 g/mol. Its IUPAC name is 2-[4-[2-(methylamino)ethyl]cyclohexyl]ethyl methanesulfonate;hydrochloride.
Molecular Properties
| Compound Name | 2-[4-[2-(methylamino)ethyl]cyclohexyl]ethyl methanesulfonate;hydrochloride |
| PubChem CID | 87926703 |
| Molecular Formula | C12H26ClNO3S |
| Molecular Weight | 299.86 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-[4-[2-(methylamino)ethyl]cyclohexyl]ethyl methanesulfonate;hydrochloride |
| SMILES | CNCCC1CCC(CCOS(C)(=O)=O)CC1.Cl |
| InChI | InChI=1S/C12H25NO3S.ClH/c1-13-9-7-11-3-5-12(6-4-11)8-10-16-17(2,14)15;/h11-13H,3-10H2,1-2H3;1H |
| InChIKey | SVXSHCHFWGIQCJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.86 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-(methylamino)ethyl]cyclohexyl]ethyl methanesulfonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(methylamino)ethyl]cyclohexyl]ethyl methanesulfonate;hydrochloride?
The IUPAC name of 2-[4-[2-(methylamino)ethyl]cyclohexyl]ethyl methanesulfonate;hydrochloride (CID 87926703) is 2-[4-[2-(methylamino)ethyl]cyclohexyl]ethyl methanesulfonate;hydrochloride.
What is the SMILES notation for 2-[4-[2-(methylamino)ethyl]cyclohexyl]ethyl methanesulfonate;hydrochloride?
The canonical SMILES for 2-[4-[2-(methylamino)ethyl]cyclohexyl]ethyl methanesulfonate;hydrochloride is CNCCC1CCC(CCOS(C)(=O)=O)CC1.Cl.
What is the InChIKey of 2-[4-[2-(methylamino)ethyl]cyclohexyl]ethyl methanesulfonate;hydrochloride?
The InChIKey is SVXSHCHFWGIQCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3S.ClH/c1-13-9-7-11-3-5-12(6-4-11)8-10-16-17(2,14)15;/h11-13H,3-10H2,1-2H3;1H.
What are the key properties of 2-[4-[2-(methylamino)ethyl]cyclohexyl]ethyl methanesulfonate;hydrochloride?
2-[4-[2-(methylamino)ethyl]cyclohexyl]ethyl methanesulfonate;hydrochloride has a molecular weight of 299.86 g/mol, XLogP of 2.19, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(methylamino)ethyl]cyclohexyl]ethyl methanesulfonate;hydrochloride is sourced from PubChem (CID 87926703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).