C20H22FN3O3S — CID 118173771
6-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfonyl-3-methylindole (PubChem CID 118173771) has the molecular formula C20H22FN3O3S and a molecular weight of 403.48 g/mol. Its IUPAC name is 6-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfonyl-3-methylindole.
| Compound Name | 6-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfonyl-3-methylindole |
|---|---|
| PubChem CID | 118173771 |
| Molecular Formula | C20H22FN3O3S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 6-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfonyl-3-methylindole |
| SMILES | COc1ccc(S(=O)(=O)n2cc(C)c3ccc(F)cc32)cc1N1CCNCC1 |
| InChI | InChI=1S/C20H22FN3O3S/c1-14-13-24(18-11-15(21)3-5-17(14)18)28(25,26)16-4-6-20(27-2)19(12-16)23-9-7-22-8-10-23/h3-6,11-13,22H,7-10H2,1-2H3 |
| InChIKey | QOUHPCKNNCZCKJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |