C20H20F3N3O3S — CID 118181441
3-(difluoromethyl)-5-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfonylindole (PubChem CID 118181441) has the molecular formula C20H20F3N3O3S and a molecular weight of 439.46 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfonylindole.
| Compound Name | 3-(difluoromethyl)-5-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 118181441 |
| Molecular Formula | C20H20F3N3O3S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 3-(difluoromethyl)-5-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfonylindole |
| SMILES | COc1ccc(S(=O)(=O)n2cc(C(F)F)c3cc(F)ccc32)cc1N1CCNCC1 |
| InChI | InChI=1S/C20H20F3N3O3S/c1-29-19-5-3-14(11-18(19)25-8-6-24-7-9-25)30(27,28)26-12-16(20(22)23)15-10-13(21)2-4-17(15)26/h2-5,10-12,20,24H,6-9H2,1H3 |
| InChIKey | BWQJXPZAUYHFOF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |