C17H13ClF2N4O2 — CID 118174017
5-[6-(chloromethoxy)-3-pyridinyl]-N-(2,6-difluorophenyl)-1-methylpyrazole-3-carboxamide (PubChem CID 118174017) has the molecular formula C17H13ClF2N4O2 and a molecular weight of 378.77 g/mol. Its IUPAC name is 5-[6-(chloromethoxy)-3-pyridinyl]-N-(2,6-difluorophenyl)-1-methylpyrazole-3-carboxamide.
| Compound Name | 5-[6-(chloromethoxy)-3-pyridinyl]-N-(2,6-difluorophenyl)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 118174017 |
| Molecular Formula | C17H13ClF2N4O2 |
| Molecular Weight | 378.77 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 5-[6-(chloromethoxy)-3-pyridinyl]-N-(2,6-difluorophenyl)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2c(F)cccc2F)cc1-c1ccc(OCCl)nc1 |
| InChI | InChI=1S/C17H13ClF2N4O2/c1-24-14(10-5-6-15(21-8-10)26-9-18)7-13(23-24)17(25)22-16-11(19)3-2-4-12(16)20/h2-8H,9H2,1H3,(H,22,25) |
| InChIKey | UREUGPGAUBXSEU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.77 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|