C17H11F4N3O — CID 90271466
N,5-bis(2,6-difluorophenyl)-1-methylpyrazole-3-carboxamide (PubChem CID 90271466) has the molecular formula C17H11F4N3O and a molecular weight of 349.29 g/mol. Its IUPAC name is N,5-bis(2,6-difluorophenyl)-1-methylpyrazole-3-carboxamide.
| Compound Name | N,5-bis(2,6-difluorophenyl)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 90271466 |
| Molecular Formula | C17H11F4N3O |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | N,5-bis(2,6-difluorophenyl)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2c(F)cccc2F)cc1-c1c(F)cccc1F |
| InChI | InChI=1S/C17H11F4N3O/c1-24-14(15-9(18)4-2-5-10(15)19)8-13(23-24)17(25)22-16-11(20)6-3-7-12(16)21/h2-8H,1H3,(H,22,25) |
| InChIKey | APRSQKBLTRGMRH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |