C25H26N2O5 — CID 118176824
2-[[(4aR,8aS)-4-hydroxy-2-oxo-1-[(4-phenylphenyl)methyl]-4a,5,6,7,8,8a-hexahydroquinoline-3-carbonyl]amino]acetic acid (PubChem CID 118176824) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is 2-[[(4aR,8aS)-4-hydroxy-2-oxo-1-[(4-phenylphenyl)methyl]-4a,5,6,7,8,8a-hexahydroquinoline-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[(4aR,8aS)-4-hydroxy-2-oxo-1-[(4-phenylphenyl)methyl]-4a,5,6,7,8,8a-hexahydroquinoline-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 118176824 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-[[(4aR,8aS)-4-hydroxy-2-oxo-1-[(4-phenylphenyl)methyl]-4a,5,6,7,8,8a-hexahydroquinoline-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1=C(O)[C@@H]2CCCC[C@@H]2N(Cc2ccc(-c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C25H26N2O5/c28-21(29)14-26-24(31)22-23(30)19-8-4-5-9-20(19)27(25(22)32)15-16-10-12-18(13-11-16)17-6-2-1-3-7-17/h1-3,6-7,10-13,19-20,30H,4-5,8-9,14-15H2,(H,26,31)(H,28,29)/t19-,20+/m1/s1 |
| InChIKey | FDTYREJYXHQUMQ-UXHICEINSA-N |
| XLogP | 3.27 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|