C27H24N2O5 — CID 118177165
2-[[4-hydroxy-6-oxo-1-[[4-(4-phenylphenyl)phenyl]methyl]-2,3-dihydropyridine-5-carbonyl]amino]acetic acid (PubChem CID 118177165) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[[4-hydroxy-6-oxo-1-[[4-(4-phenylphenyl)phenyl]methyl]-2,3-dihydropyridine-5-carbonyl]amino]acetic acid.
| Compound Name | 2-[[4-hydroxy-6-oxo-1-[[4-(4-phenylphenyl)phenyl]methyl]-2,3-dihydropyridine-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 118177165 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2-[[4-hydroxy-6-oxo-1-[[4-(4-phenylphenyl)phenyl]methyl]-2,3-dihydropyridine-5-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1=C(O)CCN(Cc2ccc(-c3ccc(-c4ccccc4)cc3)cc2)C1=O |
| InChI | InChI=1S/C27H24N2O5/c30-23-14-15-29(27(34)25(23)26(33)28-16-24(31)32)17-18-6-8-20(9-7-18)22-12-10-21(11-13-22)19-4-2-1-3-5-19/h1-13,30H,14-17H2,(H,28,33)(H,31,32) |
| InChIKey | JHAPXTVXYBSGIU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|