C21H21N3NaO6 — CID 118113236
CID 118113236 (PubChem CID 118113236) has the molecular formula C21H21N3NaO6 and a molecular weight of 434.40 g/mol.
| Compound Name | CID 118113236 |
|---|---|
| PubChem CID | 118113236 |
| Molecular Formula | C21H21N3NaO6 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | — |
| SMILES | COc1ncccc1-c1ccc(CN2CCC(O)=C(C(=O)NCC(=O)O)C2=O)cc1.[Na] |
| InChI | InChI=1S/C21H21N3O6.Na/c1-30-20-15(3-2-9-22-20)14-6-4-13(5-7-14)12-24-10-8-16(25)18(21(24)29)19(28)23-11-17(26)27;/h2-7,9,25H,8,10-12H2,1H3,(H,23,28)(H,26,27); |
| InChIKey | HMKQDXYGAUASBT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|