About CID 118113236
CID 118113236 (PubChem CID 118113236) has the molecular formula C21H21N3NaO6
and a molecular weight of 434.40 g/mol.
Molecular Properties
| Compound Name | CID 118113236 |
| PubChem CID | 118113236 |
| Molecular Formula | C21H21N3NaO6 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | — |
| SMILES | COc1ncccc1-c1ccc(CN2CCC(O)=C(C(=O)NCC(=O)O)C2=O)cc1.[Na] |
| InChI | InChI=1S/C21H21N3O6.Na/c1-30-20-15(3-2-9-22-20)14-6-4-13(5-7-14)12-24-10-8-16(25)18(21(24)29)19(28)23-11-17(26)27;/h2-7,9,25H,8,10-12H2,1H3,(H,23,28)(H,26,27); |
| InChIKey | HMKQDXYGAUASBT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze CID 118113236 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 118113236?
The IUPAC name of CID 118113236 (CID 118113236) is not available.
What is the SMILES notation for CID 118113236?
The canonical SMILES for CID 118113236 is COc1ncccc1-c1ccc(CN2CCC(O)=C(C(=O)NCC(=O)O)C2=O)cc1.[Na].
What is the InChIKey of CID 118113236?
The InChIKey is HMKQDXYGAUASBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O6.Na/c1-30-20-15(3-2-9-22-20)14-6-4-13(5-7-14)12-24-10-8-16(25)18(21(24)29)19(28)23-11-17(26)27;/h2-7,9,25H,8,10-12H2,1H3,(H,23,28)(H,26,27);.
What are the key properties of CID 118113236?
CID 118113236 has a molecular weight of 434.40 g/mol, XLogP of 1.12, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 118113236 is sourced from PubChem (CID 118113236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).