C17H18N2O8 — CID 118177078
2-[[1-[[4-(carboxymethoxy)phenyl]methyl]-4-hydroxy-6-oxo-2,3-dihydropyridine-5-carbonyl]amino]acetic acid (PubChem CID 118177078) has the molecular formula C17H18N2O8 and a molecular weight of 378.34 g/mol. Its IUPAC name is 2-[[1-[[4-(carboxymethoxy)phenyl]methyl]-4-hydroxy-6-oxo-2,3-dihydropyridine-5-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-[[4-(carboxymethoxy)phenyl]methyl]-4-hydroxy-6-oxo-2,3-dihydropyridine-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 118177078 |
| Molecular Formula | C17H18N2O8 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 2-[[1-[[4-(carboxymethoxy)phenyl]methyl]-4-hydroxy-6-oxo-2,3-dihydropyridine-5-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1=C(O)CCN(Cc2ccc(OCC(=O)O)cc2)C1=O |
| InChI | InChI=1S/C17H18N2O8/c20-12-5-6-19(17(26)15(12)16(25)18-7-13(21)22)8-10-1-3-11(4-2-10)27-9-14(23)24/h1-4,20H,5-9H2,(H,18,25)(H,21,22)(H,23,24) |
| InChIKey | OMEKTOOTGNYNJY-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|