C16H15F3N2O5 — CID 118176825
2-[[4-hydroxy-6-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydropyridine-5-carbonyl]amino]acetic acid (PubChem CID 118176825) has the molecular formula C16H15F3N2O5 and a molecular weight of 372.30 g/mol. Its IUPAC name is 2-[[4-hydroxy-6-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydropyridine-5-carbonyl]amino]acetic acid.
| Compound Name | 2-[[4-hydroxy-6-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydropyridine-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 118176825 |
| Molecular Formula | C16H15F3N2O5 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-[[4-hydroxy-6-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydropyridine-5-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1=C(O)CCN(Cc2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C16H15F3N2O5/c17-16(18,19)10-3-1-2-9(6-10)8-21-5-4-11(22)13(15(21)26)14(25)20-7-12(23)24/h1-3,6,22H,4-5,7-8H2,(H,20,25)(H,23,24) |
| InChIKey | YOMCSUAGLOVMCS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|