C17H21NO — CID 11817694
4-cyclopentyl-1-(1H-indol-3-yl)butan-2-one (PubChem CID 11817694) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 4-cyclopentyl-1-(1H-indol-3-yl)butan-2-one.
| Compound Name | 4-cyclopentyl-1-(1H-indol-3-yl)butan-2-one |
|---|---|
| PubChem CID | 11817694 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 4-cyclopentyl-1-(1H-indol-3-yl)butan-2-one |
| SMILES | O=C(CCC1CCCC1)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H21NO/c19-15(10-9-13-5-1-2-6-13)11-14-12-18-17-8-4-3-7-16(14)17/h3-4,7-8,12-13,18H,1-2,5-6,9-11H2 |
| InChIKey | XQOFTHSQUNGXHQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |