C19H23N3O5 — CID 77349115
3a,4,5,6,7,7a-hexahydroindene-1,2,3-trione;2-(1H-indol-3-yl)acetohydrazide;hydrate (PubChem CID 77349115) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 3a,4,5,6,7,7a-hexahydroindene-1,2,3-trione;2-(1H-indol-3-yl)acetohydrazide;hydrate.
| Compound Name | 3a,4,5,6,7,7a-hexahydroindene-1,2,3-trione;2-(1H-indol-3-yl)acetohydrazide;hydrate |
|---|---|
| PubChem CID | 77349115 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 3a,4,5,6,7,7a-hexahydroindene-1,2,3-trione;2-(1H-indol-3-yl)acetohydrazide;hydrate |
| SMILES | NNC(=O)Cc1c[nH]c2ccccc12.O.O=C1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C10H11N3O.C9H10O3.H2O/c11-13-10(14)5-7-6-12-9-4-2-1-3-8(7)9;10-7-5-3-1-2-4-6(5)8(11)9(7)12;/h1-4,6,12H,5,11H2,(H,13,14);5-6H,1-4H2;1H2 |
| InChIKey | OFZIDINFPIGYEZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 153.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|