C21H24FN5O5S — CID 118181156
tert-butyl N-[(2R,3S)-2-(azidomethyl)-4-(4-fluorophenyl)sulfonyl-3-methyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate (PubChem CID 118181156) has the molecular formula C21H24FN5O5S and a molecular weight of 477.52 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-2-(azidomethyl)-4-(4-fluorophenyl)sulfonyl-3-methyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-2-(azidomethyl)-4-(4-fluorophenyl)sulfonyl-3-methyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 118181156 |
| Molecular Formula | C21H24FN5O5S |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | tert-butyl N-[(2R,3S)-2-(azidomethyl)-4-(4-fluorophenyl)sulfonyl-3-methyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
| SMILES | C[C@H]1[C@@H](CN=[N+]=[N-])Oc2ccc(NC(=O)OC(C)(C)C)cc2N1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FN5O5S/c1-13-19(12-24-26-23)31-18-10-7-15(25-20(28)32-21(2,3)4)11-17(18)27(13)33(29,30)16-8-5-14(22)6-9-16/h5-11,13,19H,12H2,1-4H3,(H,25,28)/t13-,19+/m0/s1 |
| InChIKey | AILPIIIRPYYPDH-ORAYPTAESA-N |
| XLogP | 4.83 |
| TPSA | 133.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|