C21H18F7N5O5S — CID 118181163
(1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-(1-azido-2,2,2-trifluoroethyl)-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate (PubChem CID 118181163) has the molecular formula C21H18F7N5O5S and a molecular weight of 585.46 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-(1-azido-2,2,2-trifluoroethyl)-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-(1-azido-2,2,2-trifluoroethyl)-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 118181163 |
| Molecular Formula | C21H18F7N5O5S |
| Molecular Weight | 585.46 g/mol |
| Exact Mass | 585.09 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-(1-azido-2,2,2-trifluoroethyl)-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
| SMILES | CC(C)(OC(=O)Nc1ccc2c(c1)N(S(=O)(=O)c1ccc(F)cc1)CC(C(N=[N+]=[N-])C(F)(F)F)O2)C(F)(F)F |
| InChI | InChI=1S/C21H18F7N5O5S/c1-19(2,21(26,27)28)38-18(34)30-12-5-8-15-14(9-12)33(39(35,36)13-6-3-11(22)4-7-13)10-16(37-15)17(31-32-29)20(23,24)25/h3-9,16-17H,10H2,1-2H3,(H,30,34) |
| InChIKey | AZUHUTZHQLNXQE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 133.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|