C21H20F7N3O5S — CID 123486029
(1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-(1-amino-2,2,2-trifluoroethyl)-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate (PubChem CID 123486029) has the molecular formula C21H20F7N3O5S and a molecular weight of 559.46 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-(1-amino-2,2,2-trifluoroethyl)-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-(1-amino-2,2,2-trifluoroethyl)-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 123486029 |
| Molecular Formula | C21H20F7N3O5S |
| Molecular Weight | 559.46 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-(1-amino-2,2,2-trifluoroethyl)-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
| SMILES | CC(C)(OC(=O)Nc1ccc2c(c1)N(S(=O)(=O)c1ccc(F)cc1)CC(C(N)C(F)(F)F)O2)C(F)(F)F |
| InChI | InChI=1S/C21H20F7N3O5S/c1-19(2,21(26,27)28)36-18(32)30-12-5-8-15-14(9-12)31(10-16(35-15)17(29)20(23,24)25)37(33,34)13-6-3-11(22)4-7-13/h3-9,16-17H,10,29H2,1-2H3,(H,30,32) |
| InChIKey | DYXCPJAJSCHBLW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |