C26H30F4N4O7S — CID 123297292
(1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-[[(5-amino-2-methyl-5-oxopentanoyl)amino]methyl]-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate (PubChem CID 123297292) has the molecular formula C26H30F4N4O7S and a molecular weight of 618.61 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-[[(5-amino-2-methyl-5-oxopentanoyl)amino]methyl]-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-[[(5-amino-2-methyl-5-oxopentanoyl)amino]methyl]-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 123297292 |
| Molecular Formula | C26H30F4N4O7S |
| Molecular Weight | 618.61 g/mol |
| Exact Mass | 618.18 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-[[(5-amino-2-methyl-5-oxopentanoyl)amino]methyl]-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
| SMILES | CC(CCC(N)=O)C(=O)NCC1CN(S(=O)(=O)c2ccc(F)cc2)c2cc(NC(=O)OC(C)(C)C(F)(F)F)ccc2O1 |
| InChI | InChI=1S/C26H30F4N4O7S/c1-15(4-11-22(31)35)23(36)32-13-18-14-34(42(38,39)19-8-5-16(27)6-9-19)20-12-17(7-10-21(20)40-18)33-24(37)41-25(2,3)26(28,29)30/h5-10,12,15,18H,4,11,13-14H2,1-3H3,(H2,31,35)(H,32,36)(H,33,37) |
| InChIKey | SOZXBJJGSHXCMN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |