C26H29F4N3O7S — CID 118180668
(1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-4-(4-fluorophenyl)sulfonyl-2-[[(3-methoxycyclobutanecarbonyl)amino]methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate (PubChem CID 118180668) has the molecular formula C26H29F4N3O7S and a molecular weight of 603.59 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-4-(4-fluorophenyl)sulfonyl-2-[[(3-methoxycyclobutanecarbonyl)amino]methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-4-(4-fluorophenyl)sulfonyl-2-[[(3-methoxycyclobutanecarbonyl)amino]methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 118180668 |
| Molecular Formula | C26H29F4N3O7S |
| Molecular Weight | 603.59 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-4-(4-fluorophenyl)sulfonyl-2-[[(3-methoxycyclobutanecarbonyl)amino]methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
| SMILES | COC1CC(C(=O)NC[C@H]2CN(S(=O)(=O)c3ccc(F)cc3)c3cc(NC(=O)OC(C)(C)C(F)(F)F)ccc3O2)C1 |
| InChI | InChI=1S/C26H29F4N3O7S/c1-25(2,26(28,29)30)40-24(35)32-17-6-9-22-21(12-17)33(41(36,37)20-7-4-16(27)5-8-20)14-19(39-22)13-31-23(34)15-10-18(11-15)38-3/h4-9,12,15,18-19H,10-11,13-14H2,1-3H3,(H,31,34)(H,32,35)/t15?,18?,19-/m0/s1 |
| InChIKey | JXCOFHATLMVZSY-PPSBMQLTSA-N |
| XLogP | 4.21 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |