C27H31F4N3O6S — CID 118180670
(1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2R)-4-(4-fluorophenyl)sulfonyl-2-[[(1-methylcyclopentanecarbonyl)amino]methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate (PubChem CID 118180670) has the molecular formula C27H31F4N3O6S and a molecular weight of 601.62 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2R)-4-(4-fluorophenyl)sulfonyl-2-[[(1-methylcyclopentanecarbonyl)amino]methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2R)-4-(4-fluorophenyl)sulfonyl-2-[[(1-methylcyclopentanecarbonyl)amino]methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 118180670 |
| Molecular Formula | C27H31F4N3O6S |
| Molecular Weight | 601.62 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2R)-4-(4-fluorophenyl)sulfonyl-2-[[(1-methylcyclopentanecarbonyl)amino]methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
| SMILES | CC1(C(=O)NC[C@@H]2CN(S(=O)(=O)c3ccc(F)cc3)c3cc(NC(=O)OC(C)(C)C(F)(F)F)ccc3O2)CCCC1 |
| InChI | InChI=1S/C27H31F4N3O6S/c1-25(2,27(29,30)31)40-24(36)33-18-8-11-22-21(14-18)34(41(37,38)20-9-6-17(28)7-10-20)16-19(39-22)15-32-23(35)26(3)12-4-5-13-26/h6-11,14,19H,4-5,12-13,15-16H2,1-3H3,(H,32,35)(H,33,36)/t19-/m1/s1 |
| InChIKey | DHGDSEYPWRREJS-LJQANCHMSA-N |
| XLogP | 5.37 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.62 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |