C24H28F4N4O7S2 — CID 118187248
(1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-4-(4-fluorophenyl)sulfonyl-2-[(pyrrolidin-1-ylsulfonylamino)methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate (PubChem CID 118187248) has the molecular formula C24H28F4N4O7S2 and a molecular weight of 624.64 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-4-(4-fluorophenyl)sulfonyl-2-[(pyrrolidin-1-ylsulfonylamino)methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-4-(4-fluorophenyl)sulfonyl-2-[(pyrrolidin-1-ylsulfonylamino)methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 118187248 |
| Molecular Formula | C24H28F4N4O7S2 |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 624.13 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-4-(4-fluorophenyl)sulfonyl-2-[(pyrrolidin-1-ylsulfonylamino)methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
| SMILES | CC(C)(OC(=O)Nc1ccc2c(c1)N(S(=O)(=O)c1ccc(F)cc1)C[C@H](CNS(=O)(=O)N1CCCC1)O2)C(F)(F)F |
| InChI | InChI=1S/C24H28F4N4O7S2/c1-23(2,24(26,27)28)39-22(33)30-17-7-10-21-20(13-17)32(40(34,35)19-8-5-16(25)6-9-19)15-18(38-21)14-29-41(36,37)31-11-3-4-12-31/h5-10,13,18,29H,3-4,11-12,14-15H2,1-2H3,(H,30,33)/t18-/m0/s1 |
| InChIKey | SFWQUQVLEGRYNH-SFHVURJKSA-N |
| XLogP | 3.60 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |