C26H32F4N4O7S2 — CID 123975091
(1,1,1-trifluoro-2-methylpropan-2-yl) N-[4-(4-fluorophenyl)sulfonyl-2-[[(4-methylpiperidin-1-yl)sulfonylamino]methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate (PubChem CID 123975091) has the molecular formula C26H32F4N4O7S2 and a molecular weight of 652.69 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) N-[4-(4-fluorophenyl)sulfonyl-2-[[(4-methylpiperidin-1-yl)sulfonylamino]methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[4-(4-fluorophenyl)sulfonyl-2-[[(4-methylpiperidin-1-yl)sulfonylamino]methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 123975091 |
| Molecular Formula | C26H32F4N4O7S2 |
| Molecular Weight | 652.69 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[4-(4-fluorophenyl)sulfonyl-2-[[(4-methylpiperidin-1-yl)sulfonylamino]methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
| SMILES | CC1CCN(S(=O)(=O)NCC2CN(S(=O)(=O)c3ccc(F)cc3)c3cc(NC(=O)OC(C)(C)C(F)(F)F)ccc3O2)CC1 |
| InChI | InChI=1S/C26H32F4N4O7S2/c1-17-10-12-33(13-11-17)43(38,39)31-15-20-16-34(42(36,37)21-7-4-18(27)5-8-21)22-14-19(6-9-23(22)40-20)32-24(35)41-25(2,3)26(28,29)30/h4-9,14,17,20,31H,10-13,15-16H2,1-3H3,(H,32,35) |
| InChIKey | SICNUIVBJLZYPD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.69 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |